C7H8F3NO3 — CID 46217578
methyl (Z)-4,4,4-trifluoro-2-formamido-3-methylbut-2-enoate (PubChem CID 46217578) has the molecular formula C7H8F3NO3 and a molecular weight of 211.14 g/mol. Its IUPAC name is methyl (Z)-4,4,4-trifluoro-2-formamido-3-methylbut-2-enoate.
| Compound Name | methyl (Z)-4,4,4-trifluoro-2-formamido-3-methylbut-2-enoate |
|---|---|
| PubChem CID | 46217578 |
| Molecular Formula | C7H8F3NO3 |
| Molecular Weight | 211.14 g/mol |
| Exact Mass | 211.05 |
| IUPAC Name | methyl (Z)-4,4,4-trifluoro-2-formamido-3-methylbut-2-enoate |
| SMILES | COC(=O)/C(NC=O)=C(\C)C(F)(F)F |
| InChI | InChI=1S/C7H8F3NO3/c1-4(7(8,9)10)5(11-3-12)6(13)14-2/h3H,1-2H3,(H,11,12)/b5-4- |
| InChIKey | FULHLXODPXRDMG-PLNGDYQASA-N |
| XLogP | 0.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.14 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|