C12H16F3NO5 — CID 72961643
dimethyl 2-(2,2-dimethylpropanoylamino)-3-(trifluoromethyl)but-2-enedioate (PubChem CID 72961643) has the molecular formula C12H16F3NO5 and a molecular weight of 311.26 g/mol. Its IUPAC name is dimethyl 2-(2,2-dimethylpropanoylamino)-3-(trifluoromethyl)but-2-enedioate.
| Compound Name | dimethyl 2-(2,2-dimethylpropanoylamino)-3-(trifluoromethyl)but-2-enedioate |
|---|---|
| PubChem CID | 72961643 |
| Molecular Formula | C12H16F3NO5 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | dimethyl 2-(2,2-dimethylpropanoylamino)-3-(trifluoromethyl)but-2-enedioate |
| SMILES | COC(=O)C(NC(=O)C(C)(C)C)=C(C(=O)OC)C(F)(F)F |
| InChI | InChI=1S/C12H16F3NO5/c1-11(2,3)10(19)16-7(9(18)21-5)6(8(17)20-4)12(13,14)15/h1-5H3,(H,16,19) |
| InChIKey | MISZAESMGZZHCY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|