C10H20N2O2 — CID 58200215
N-(tert-butylcarbamoyl)-2,2-dimethylpropanamide (PubChem CID 58200215) has the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. Its IUPAC name is N-(tert-butylcarbamoyl)-2,2-dimethylpropanamide.
| Compound Name | N-(tert-butylcarbamoyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 58200215 |
| Molecular Formula | C10H20N2O2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.15 |
| IUPAC Name | N-(tert-butylcarbamoyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)NC(=O)NC(=O)C(C)(C)C |
| InChI | InChI=1S/C10H20N2O2/c1-9(2,3)7(13)11-8(14)12-10(4,5)6/h1-6H3,(H2,11,12,13,14) |
| InChIKey | FVVAHYNGQATVQJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |