C11H24N2O — CID 159105073
1-tert-butyl-3-[(2S)-3,3-dimethylbutan-2-yl]urea (PubChem CID 159105073) has the molecular formula C11H24N2O and a molecular weight of 200.33 g/mol. Its IUPAC name is 1-tert-butyl-3-[(2S)-3,3-dimethylbutan-2-yl]urea.
| Compound Name | 1-tert-butyl-3-[(2S)-3,3-dimethylbutan-2-yl]urea |
|---|---|
| PubChem CID | 159105073 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 1-tert-butyl-3-[(2S)-3,3-dimethylbutan-2-yl]urea |
| SMILES | C[C@H](NC(=O)NC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H24N2O/c1-8(10(2,3)4)12-9(14)13-11(5,6)7/h8H,1-7H3,(H2,12,13,14)/t8-/m0/s1 |
| InChIKey | KDTWKXXZICJXCD-QMMMGPOBSA-N |
| XLogP | 2.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |