About 1-tert-butyl-3-[(2S)-3,3-dimethylbutan-2-yl]urea
1-tert-butyl-3-[(2S)-3,3-dimethylbutan-2-yl]urea (PubChem CID 159105073) has the molecular formula C11H24N2O
and a molecular weight of 200.33 g/mol. Its IUPAC name is 1-tert-butyl-3-[(2S)-3,3-dimethylbutan-2-yl]urea.
Molecular Properties
| Compound Name | 1-tert-butyl-3-[(2S)-3,3-dimethylbutan-2-yl]urea |
| PubChem CID | 159105073 |
| Molecular Formula | C11H24N2O |
| Molecular Weight | 200.33 g/mol |
| Exact Mass | 200.19 |
| IUPAC Name | 1-tert-butyl-3-[(2S)-3,3-dimethylbutan-2-yl]urea |
| SMILES | C[C@H](NC(=O)NC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C11H24N2O/c1-8(10(2,3)4)12-9(14)13-11(5,6)7/h8H,1-7H3,(H2,12,13,14)/t8-/m0/s1 |
| InChIKey | KDTWKXXZICJXCD-QMMMGPOBSA-N |
| XLogP | 2.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.33 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-tert-butyl-3-[(2S)-3,3-dimethylbutan-2-yl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tert-butyl-3-[(2S)-3,3-dimethylbutan-2-yl]urea?
The IUPAC name of 1-tert-butyl-3-[(2S)-3,3-dimethylbutan-2-yl]urea (CID 159105073) is 1-tert-butyl-3-[(2S)-3,3-dimethylbutan-2-yl]urea.
What is the SMILES notation for 1-tert-butyl-3-[(2S)-3,3-dimethylbutan-2-yl]urea?
The canonical SMILES for 1-tert-butyl-3-[(2S)-3,3-dimethylbutan-2-yl]urea is C[C@H](NC(=O)NC(C)(C)C)C(C)(C)C.
What is the InChIKey of 1-tert-butyl-3-[(2S)-3,3-dimethylbutan-2-yl]urea?
The InChIKey is KDTWKXXZICJXCD-QMMMGPOBSA-N. The full InChI is InChI=1S/C11H24N2O/c1-8(10(2,3)4)12-9(14)13-11(5,6)7/h8H,1-7H3,(H2,12,13,14)/t8-/m0/s1.
What are the key properties of 1-tert-butyl-3-[(2S)-3,3-dimethylbutan-2-yl]urea?
1-tert-butyl-3-[(2S)-3,3-dimethylbutan-2-yl]urea has a molecular weight of 200.33 g/mol, XLogP of 2.52, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tert-butyl-3-[(2S)-3,3-dimethylbutan-2-yl]urea is sourced from PubChem (CID 159105073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).