C14H28N2O3 — CID 113331477
tert-butyl (2R)-2-(tert-butylcarbamoylamino)-3-methylbutanoate (PubChem CID 113331477) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is tert-butyl (2R)-2-(tert-butylcarbamoylamino)-3-methylbutanoate.
| Compound Name | tert-butyl (2R)-2-(tert-butylcarbamoylamino)-3-methylbutanoate |
|---|---|
| PubChem CID | 113331477 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | tert-butyl (2R)-2-(tert-butylcarbamoylamino)-3-methylbutanoate |
| SMILES | CC(C)[C@@H](NC(=O)NC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H28N2O3/c1-9(2)10(11(17)19-14(6,7)8)15-12(18)16-13(3,4)5/h9-10H,1-8H3,(H2,15,16,18)/t10-/m1/s1 |
| InChIKey | IZNGJDNMZBNKBM-SNVBAGLBSA-N |
| XLogP | 2.45 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |