C14H29ClN2O3 — CID 131713272
tert-butyl (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-methylbutanoate;hydrochloride (PubChem CID 131713272) has the molecular formula C14H29ClN2O3 and a molecular weight of 308.85 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-methylbutanoate;hydrochloride.
| Compound Name | tert-butyl (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-methylbutanoate;hydrochloride |
|---|---|
| PubChem CID | 131713272 |
| Molecular Formula | C14H29ClN2O3 |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-amino-3-methylbutanoyl]amino]-3-methylbutanoate;hydrochloride |
| SMILES | CC(C)[C@H](N)C(=O)N[C@H](C(=O)OC(C)(C)C)C(C)C.Cl |
| InChI | InChI=1S/C14H28N2O3.ClH/c1-8(2)10(15)12(17)16-11(9(3)4)13(18)19-14(5,6)7;/h8-11H,15H2,1-7H3,(H,16,17);1H/t10-,11-;/m0./s1 |
| InChIKey | WGVXHKMFOQWBOP-ACMTZBLWSA-N |
| XLogP | 1.87 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |