C16H30N2O4 — CID 58786092
tert-butyl (2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-3-methylbutanoate (PubChem CID 58786092) has the molecular formula C16H30N2O4 and a molecular weight of 314.43 g/mol. Its IUPAC name is tert-butyl (2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-3-methylbutanoate.
| Compound Name | tert-butyl (2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 58786092 |
| Molecular Formula | C16H30N2O4 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.22 |
| IUPAC Name | tert-butyl (2S)-2-[[(2S)-2-acetamido-3-methylbutanoyl]amino]-3-methylbutanoate |
| SMILES | CC(=O)N[C@H](C(=O)N[C@H](C(=O)OC(C)(C)C)C(C)C)C(C)C |
| InChI | InChI=1S/C16H30N2O4/c1-9(2)12(17-11(5)19)14(20)18-13(10(3)4)15(21)22-16(6,7)8/h9-10,12-13H,1-8H3,(H,17,19)(H,18,20)/t12-,13-/m0/s1 |
| InChIKey | ULZSNFUPTIJTPQ-STQMWFEESA-N |
| XLogP | 1.63 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |