C13H24N2O4 — CID 81003713
tert-butyl (2R)-2-[(2-acetamidoacetyl)amino]-3-methylbutanoate (PubChem CID 81003713) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is tert-butyl (2R)-2-[(2-acetamidoacetyl)amino]-3-methylbutanoate.
| Compound Name | tert-butyl (2R)-2-[(2-acetamidoacetyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 81003713 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | tert-butyl (2R)-2-[(2-acetamidoacetyl)amino]-3-methylbutanoate |
| SMILES | CC(=O)NCC(=O)N[C@@H](C(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C13H24N2O4/c1-8(2)11(12(18)19-13(4,5)6)15-10(17)7-14-9(3)16/h8,11H,7H2,1-6H3,(H,14,16)(H,15,17)/t11-/m1/s1 |
| InChIKey | CEQGUPDYRZTTLO-LLVKDONJSA-N |
| XLogP | 0.61 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |