C13H25NO3S — CID 81003425
tert-butyl (2R)-3-methyl-2-(3-methylsulfanylpropanoylamino)butanoate (PubChem CID 81003425) has the molecular formula C13H25NO3S and a molecular weight of 275.41 g/mol. Its IUPAC name is tert-butyl (2R)-3-methyl-2-(3-methylsulfanylpropanoylamino)butanoate.
| Compound Name | tert-butyl (2R)-3-methyl-2-(3-methylsulfanylpropanoylamino)butanoate |
|---|---|
| PubChem CID | 81003425 |
| Molecular Formula | C13H25NO3S |
| Molecular Weight | 275.41 g/mol |
| Exact Mass | 275.16 |
| IUPAC Name | tert-butyl (2R)-3-methyl-2-(3-methylsulfanylpropanoylamino)butanoate |
| SMILES | CSCCC(=O)N[C@@H](C(=O)OC(C)(C)C)C(C)C |
| InChI | InChI=1S/C13H25NO3S/c1-9(2)11(12(16)17-13(3,4)5)14-10(15)7-8-18-6/h9,11H,7-8H2,1-6H3,(H,14,15)/t11-/m1/s1 |
| InChIKey | AALCHHFZOUNDGP-LLVKDONJSA-N |
| XLogP | 2.22 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.41 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |