C8H14F3NO — CID 15742934
N-[(2R)-3,3-dimethylbutan-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 15742934) has the molecular formula C8H14F3NO and a molecular weight of 197.20 g/mol. Its IUPAC name is N-[(2R)-3,3-dimethylbutan-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(2R)-3,3-dimethylbutan-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 15742934 |
| Molecular Formula | C8H14F3NO |
| Molecular Weight | 197.20 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | N-[(2R)-3,3-dimethylbutan-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@@H](NC(=O)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C8H14F3NO/c1-5(7(2,3)4)12-6(13)8(9,10)11/h5H,1-4H3,(H,12,13)/t5-/m1/s1 |
| InChIKey | GQWXVNZQPVNPGR-RXMQYKEDSA-N |
| XLogP | 2.10 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.20 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |