C7H10F3NO — CID 125476431
2,2,2-trifluoro-N-[(E,2S)-pent-3-en-2-yl]acetamide (PubChem CID 125476431) has the molecular formula C7H10F3NO and a molecular weight of 181.16 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(E,2S)-pent-3-en-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(E,2S)-pent-3-en-2-yl]acetamide |
|---|---|
| PubChem CID | 125476431 |
| Molecular Formula | C7H10F3NO |
| Molecular Weight | 181.16 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | 2,2,2-trifluoro-N-[(E,2S)-pent-3-en-2-yl]acetamide |
| SMILES | C/C=C/[C@H](C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C7H10F3NO/c1-3-4-5(2)11-6(12)7(8,9)10/h3-5H,1-2H3,(H,11,12)/b4-3+/t5-/m0/s1 |
| InChIKey | JSTRGHYUIGNDSS-BHYDHMSTSA-N |
| XLogP | 1.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.16 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|