C9H12F3NO3 — CID 101004551
N-[(E,2S)-4-(1,3-dioxolan-2-yl)but-3-en-2-yl]-2,2,2-trifluoroacetamide (PubChem CID 101004551) has the molecular formula C9H12F3NO3 and a molecular weight of 239.19 g/mol. Its IUPAC name is N-[(E,2S)-4-(1,3-dioxolan-2-yl)but-3-en-2-yl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[(E,2S)-4-(1,3-dioxolan-2-yl)but-3-en-2-yl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 101004551 |
| Molecular Formula | C9H12F3NO3 |
| Molecular Weight | 239.19 g/mol |
| Exact Mass | 239.08 |
| IUPAC Name | N-[(E,2S)-4-(1,3-dioxolan-2-yl)but-3-en-2-yl]-2,2,2-trifluoroacetamide |
| SMILES | C[C@@H](/C=C/C1OCCO1)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H12F3NO3/c1-6(13-8(14)9(10,11)12)2-3-7-15-4-5-16-7/h2-3,6-7H,4-5H2,1H3,(H,13,14)/b3-2+/t6-/m0/s1 |
| InChIKey | VNAFFOUSVXTQHJ-SZKDQXIBSA-N |
| XLogP | 0.98 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.19 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|