C8H12F3NO2 — CID 23657256
2,2,2-trifluoro-N-[(Z,2S)-6-hydroxyhex-3-en-2-yl]acetamide (PubChem CID 23657256) has the molecular formula C8H12F3NO2 and a molecular weight of 211.18 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[(Z,2S)-6-hydroxyhex-3-en-2-yl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[(Z,2S)-6-hydroxyhex-3-en-2-yl]acetamide |
|---|---|
| PubChem CID | 23657256 |
| Molecular Formula | C8H12F3NO2 |
| Molecular Weight | 211.18 g/mol |
| Exact Mass | 211.08 |
| IUPAC Name | 2,2,2-trifluoro-N-[(Z,2S)-6-hydroxyhex-3-en-2-yl]acetamide |
| SMILES | C[C@@H](/C=C\CCO)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO2/c1-6(4-2-3-5-13)12-7(14)8(9,10)11/h2,4,6,13H,3,5H2,1H3,(H,12,14)/b4-2-/t6-/m0/s1 |
| InChIKey | VKLKDNZBYXYRLV-DNDNTSGYSA-N |
| XLogP | 0.99 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.18 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|