C8H11F6N3O2 — CID 22561436
2,2,2-trifluoro-N-[1-[1-[(2,2,2-trifluoroacetyl)amino]ethylamino]ethyl]acetamide (PubChem CID 22561436) has the molecular formula C8H11F6N3O2 and a molecular weight of 295.18 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[1-[1-[(2,2,2-trifluoroacetyl)amino]ethylamino]ethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-[1-[1-[(2,2,2-trifluoroacetyl)amino]ethylamino]ethyl]acetamide |
|---|---|
| PubChem CID | 22561436 |
| Molecular Formula | C8H11F6N3O2 |
| Molecular Weight | 295.18 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2,2,2-trifluoro-N-[1-[1-[(2,2,2-trifluoroacetyl)amino]ethylamino]ethyl]acetamide |
| SMILES | CC(NC(=O)C(F)(F)F)NC(C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H11F6N3O2/c1-3(16-5(18)7(9,10)11)15-4(2)17-6(19)8(12,13)14/h3-4,15H,1-2H3,(H,16,18)(H,17,19) |
| InChIKey | RFPNIBHNLBZJAC-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.18 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|