C8H13F3N2O2 — CID 62492310
N-propyl-2-[(2,2,2-trifluoroacetyl)amino]propanamide (PubChem CID 62492310) has the molecular formula C8H13F3N2O2 and a molecular weight of 226.20 g/mol. Its IUPAC name is N-propyl-2-[(2,2,2-trifluoroacetyl)amino]propanamide.
| Compound Name | N-propyl-2-[(2,2,2-trifluoroacetyl)amino]propanamide |
|---|---|
| PubChem CID | 62492310 |
| Molecular Formula | C8H13F3N2O2 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | N-propyl-2-[(2,2,2-trifluoroacetyl)amino]propanamide |
| SMILES | CCCNC(=O)C(C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H13F3N2O2/c1-3-4-12-6(14)5(2)13-7(15)8(9,10)11/h5H,3-4H2,1-2H3,(H,12,14)(H,13,15) |
| InChIKey | TZQCPSVUXGLDMD-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |