C16H29F3N2O2 — CID 172907302
3,3-dimethyl-N-octyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide (PubChem CID 172907302) has the molecular formula C16H29F3N2O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3,3-dimethyl-N-octyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide.
| Compound Name | 3,3-dimethyl-N-octyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide |
|---|---|
| PubChem CID | 172907302 |
| Molecular Formula | C16H29F3N2O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 3,3-dimethyl-N-octyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide |
| SMILES | CCCCCCCCNC(=O)C(NC(=O)C(F)(F)F)C(C)(C)C |
| InChI | InChI=1S/C16H29F3N2O2/c1-5-6-7-8-9-10-11-20-13(22)12(15(2,3)4)21-14(23)16(17,18)19/h12H,5-11H2,1-4H3,(H,20,22)(H,21,23) |
| InChIKey | XXGNTUBPVDAELB-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|