C17H32F3NO — CID 150813708
N-(4,4-dimethyltridecyl)-2,2,2-trifluoroacetamide (PubChem CID 150813708) has the molecular formula C17H32F3NO and a molecular weight of 323.44 g/mol. Its IUPAC name is N-(4,4-dimethyltridecyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(4,4-dimethyltridecyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 150813708 |
| Molecular Formula | C17H32F3NO |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.24 |
| IUPAC Name | N-(4,4-dimethyltridecyl)-2,2,2-trifluoroacetamide |
| SMILES | CCCCCCCCCC(C)(C)CCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C17H32F3NO/c1-4-5-6-7-8-9-10-12-16(2,3)13-11-14-21-15(22)17(18,19)20/h4-14H2,1-3H3,(H,21,22) |
| InChIKey | KIKQMOYFOWSEST-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|