C15H24F6N2O2 — CID 17285414
N-[4-ethyl-4-[[(2,2,2-trifluoroacetyl)amino]methyl]octyl]-2,2,2-trifluoroacetamide (PubChem CID 17285414) has the molecular formula C15H24F6N2O2 and a molecular weight of 378.36 g/mol. Its IUPAC name is N-[4-ethyl-4-[[(2,2,2-trifluoroacetyl)amino]methyl]octyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[4-ethyl-4-[[(2,2,2-trifluoroacetyl)amino]methyl]octyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 17285414 |
| Molecular Formula | C15H24F6N2O2 |
| Molecular Weight | 378.36 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | N-[4-ethyl-4-[[(2,2,2-trifluoroacetyl)amino]methyl]octyl]-2,2,2-trifluoroacetamide |
| SMILES | CCCCC(CC)(CCCNC(=O)C(F)(F)F)CNC(=O)C(F)(F)F |
| InChI | InChI=1S/C15H24F6N2O2/c1-3-5-7-13(4-2,10-23-12(25)15(19,20)21)8-6-9-22-11(24)14(16,17)18/h3-10H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | WPDMYIAJLCKCPI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|