C7H13F3NOS+ — CID 172843562
dimethyl-[3-[(2,2,2-trifluoroacetyl)amino]propyl]sulfanium (PubChem CID 172843562) has the molecular formula C7H13F3NOS+ and a molecular weight of 216.25 g/mol. Its IUPAC name is dimethyl-[3-[(2,2,2-trifluoroacetyl)amino]propyl]sulfanium.
| Compound Name | dimethyl-[3-[(2,2,2-trifluoroacetyl)amino]propyl]sulfanium |
|---|---|
| PubChem CID | 172843562 |
| Molecular Formula | C7H13F3NOS+ |
| Molecular Weight | 216.25 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | dimethyl-[3-[(2,2,2-trifluoroacetyl)amino]propyl]sulfanium |
| SMILES | C[S+](C)CCCNC(=O)C(F)(F)F |
| InChI | InChI=1S/C7H12F3NOS/c1-13(2)5-3-4-11-6(12)7(8,9)10/h3-5H2,1-2H3/p+1 |
| InChIKey | XCRIAVIBFRBTPF-UHFFFAOYSA-O |
| XLogP | 0.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.25 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|