C12H18F6N2O5P+ — CID 11668829
oxo-bis[4-[(2,2,2-trifluoroacetyl)amino]butoxy]phosphanium (PubChem CID 11668829) has the molecular formula C12H18F6N2O5P+ and a molecular weight of 415.25 g/mol. Its IUPAC name is oxo-bis[4-[(2,2,2-trifluoroacetyl)amino]butoxy]phosphanium.
| Compound Name | oxo-bis[4-[(2,2,2-trifluoroacetyl)amino]butoxy]phosphanium |
|---|---|
| PubChem CID | 11668829 |
| Molecular Formula | C12H18F6N2O5P+ |
| Molecular Weight | 415.25 g/mol |
| Exact Mass | 415.09 |
| IUPAC Name | oxo-bis[4-[(2,2,2-trifluoroacetyl)amino]butoxy]phosphanium |
| SMILES | O=C(NCCCCO[P+](=O)OCCCCNC(=O)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H17F6N2O5P/c13-11(14,15)9(21)19-5-1-3-7-24-26(23)25-8-4-2-6-20-10(22)12(16,17)18/h1-8H2,(H-,19,20,21,22)/p+1 |
| InChIKey | RETAZYMKXHHFQA-UHFFFAOYSA-O |
| XLogP | 2.59 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.25 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|