C16H32N2O2 — CID 170384014
N-butyl-5-(2,2-dimethylpropanoylamino)-2,2-dimethylpentanamide (PubChem CID 170384014) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is N-butyl-5-(2,2-dimethylpropanoylamino)-2,2-dimethylpentanamide.
| Compound Name | N-butyl-5-(2,2-dimethylpropanoylamino)-2,2-dimethylpentanamide |
|---|---|
| PubChem CID | 170384014 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | N-butyl-5-(2,2-dimethylpropanoylamino)-2,2-dimethylpentanamide |
| SMILES | CCCCNC(=O)C(C)(C)CCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H32N2O2/c1-7-8-11-18-14(20)16(5,6)10-9-12-17-13(19)15(2,3)4/h7-12H2,1-6H3,(H,17,19)(H,18,20) |
| InChIKey | WWIAXCFKLICTOC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|