C13H28N4O — CID 111152372
N-[2-[(N-butyl-N'-methylcarbamimidoyl)amino]ethyl]-2,2-dimethylpropanamide (PubChem CID 111152372) has the molecular formula C13H28N4O and a molecular weight of 256.39 g/mol. Its IUPAC name is N-[2-[(N-butyl-N'-methylcarbamimidoyl)amino]ethyl]-2,2-dimethylpropanamide.
| Compound Name | N-[2-[(N-butyl-N'-methylcarbamimidoyl)amino]ethyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 111152372 |
| Molecular Formula | C13H28N4O |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.23 |
| IUPAC Name | N-[2-[(N-butyl-N'-methylcarbamimidoyl)amino]ethyl]-2,2-dimethylpropanamide |
| SMILES | CCCCN/C(=N\C)NCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C13H28N4O/c1-6-7-8-16-12(14-5)17-10-9-15-11(18)13(2,3)4/h6-10H2,1-5H3,(H,15,18)(H2,14,16,17) |
| InChIKey | NMCMAXDBASCIKP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|