C14H28N4O2S2 — CID 150928409
N-butyl-2-[[1-(butylamino)-1-oxo-2-sulfanylpropan-2-yl]diazenyl]-2-sulfanylpropanamide (PubChem CID 150928409) has the molecular formula C14H28N4O2S2 and a molecular weight of 348.54 g/mol. Its IUPAC name is N-butyl-2-[[1-(butylamino)-1-oxo-2-sulfanylpropan-2-yl]diazenyl]-2-sulfanylpropanamide.
| Compound Name | N-butyl-2-[[1-(butylamino)-1-oxo-2-sulfanylpropan-2-yl]diazenyl]-2-sulfanylpropanamide |
|---|---|
| PubChem CID | 150928409 |
| Molecular Formula | C14H28N4O2S2 |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | N-butyl-2-[[1-(butylamino)-1-oxo-2-sulfanylpropan-2-yl]diazenyl]-2-sulfanylpropanamide |
| SMILES | CCCCNC(=O)C(C)(S)N=NC(C)(S)C(=O)NCCCC |
| InChI | InChI=1S/C14H28N4O2S2/c1-5-7-9-15-11(19)13(3,21)17-18-14(4,22)12(20)16-10-8-6-2/h21-22H,5-10H2,1-4H3,(H,15,19)(H,16,20) |
| InChIKey | LFMSSOZJSYSJOT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|