C16H32N2O2 — CID 134575982
6-(2,2-dimethylpropanoylamino)-2,2-dimethyl-N-propan-2-ylhexanamide (PubChem CID 134575982) has the molecular formula C16H32N2O2 and a molecular weight of 284.44 g/mol. Its IUPAC name is 6-(2,2-dimethylpropanoylamino)-2,2-dimethyl-N-propan-2-ylhexanamide.
| Compound Name | 6-(2,2-dimethylpropanoylamino)-2,2-dimethyl-N-propan-2-ylhexanamide |
|---|---|
| PubChem CID | 134575982 |
| Molecular Formula | C16H32N2O2 |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.25 |
| IUPAC Name | 6-(2,2-dimethylpropanoylamino)-2,2-dimethyl-N-propan-2-ylhexanamide |
| SMILES | CC(C)NC(=O)C(C)(C)CCCCNC(=O)C(C)(C)C |
| InChI | InChI=1S/C16H32N2O2/c1-12(2)18-14(20)16(6,7)10-8-9-11-17-13(19)15(3,4)5/h12H,8-11H2,1-7H3,(H,17,19)(H,18,20) |
| InChIKey | KPEPZVWYWQNPJY-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|