C19H38N2O2 — CID 126680891
N-[6-(2,2-dimethylpropanoylamino)-5,6-dimethylheptyl]-2,2-dimethylpropanamide (PubChem CID 126680891) has the molecular formula C19H38N2O2 and a molecular weight of 326.53 g/mol. Its IUPAC name is N-[6-(2,2-dimethylpropanoylamino)-5,6-dimethylheptyl]-2,2-dimethylpropanamide.
| Compound Name | N-[6-(2,2-dimethylpropanoylamino)-5,6-dimethylheptyl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 126680891 |
| Molecular Formula | C19H38N2O2 |
| Molecular Weight | 326.53 g/mol |
| Exact Mass | 326.29 |
| IUPAC Name | N-[6-(2,2-dimethylpropanoylamino)-5,6-dimethylheptyl]-2,2-dimethylpropanamide |
| SMILES | CC(CCCCNC(=O)C(C)(C)C)C(C)(C)NC(=O)C(C)(C)C |
| InChI | InChI=1S/C19H38N2O2/c1-14(19(8,9)21-16(23)18(5,6)7)12-10-11-13-20-15(22)17(2,3)4/h14H,10-13H2,1-9H3,(H,20,22)(H,21,23) |
| InChIKey | SFANQFQZTBQFID-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.53 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|