C23H38N2O6 — CID 129094156
(4-methyl-3-oxopent-4-en-2-yl) N-[2,3-dimethyl-7-[(4-methyl-3-oxopent-4-en-2-yl)oxycarbonylamino]heptan-2-yl]carbamate (PubChem CID 129094156) has the molecular formula C23H38N2O6 and a molecular weight of 438.57 g/mol. Its IUPAC name is (4-methyl-3-oxopent-4-en-2-yl) N-[2,3-dimethyl-7-[(4-methyl-3-oxopent-4-en-2-yl)oxycarbonylamino]heptan-2-yl]carbamate.
| Compound Name | (4-methyl-3-oxopent-4-en-2-yl) N-[2,3-dimethyl-7-[(4-methyl-3-oxopent-4-en-2-yl)oxycarbonylamino]heptan-2-yl]carbamate |
|---|---|
| PubChem CID | 129094156 |
| Molecular Formula | C23H38N2O6 |
| Molecular Weight | 438.57 g/mol |
| Exact Mass | 438.27 |
| IUPAC Name | (4-methyl-3-oxopent-4-en-2-yl) N-[2,3-dimethyl-7-[(4-methyl-3-oxopent-4-en-2-yl)oxycarbonylamino]heptan-2-yl]carbamate |
| SMILES | C=C(C)C(=O)C(C)OC(=O)NCCCCC(C)C(C)(C)NC(=O)OC(C)C(=O)C(=C)C |
| InChI | InChI=1S/C23H38N2O6/c1-14(2)19(26)17(6)30-21(28)24-13-11-10-12-16(5)23(8,9)25-22(29)31-18(7)20(27)15(3)4/h16-18H,1,3,10-13H2,2,4-9H3,(H,24,28)(H,25,29) |
| InChIKey | JCPBHWAPKGICLV-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.57 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|