C9H13NO3 — CID 87670919
(4-methyl-3-oxopent-4-en-2-yl) N-ethenylcarbamate (PubChem CID 87670919) has the molecular formula C9H13NO3 and a molecular weight of 183.21 g/mol. Its IUPAC name is (4-methyl-3-oxopent-4-en-2-yl) N-ethenylcarbamate.
| Compound Name | (4-methyl-3-oxopent-4-en-2-yl) N-ethenylcarbamate |
|---|---|
| PubChem CID | 87670919 |
| Molecular Formula | C9H13NO3 |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.09 |
| IUPAC Name | (4-methyl-3-oxopent-4-en-2-yl) N-ethenylcarbamate |
| SMILES | C=CNC(=O)OC(C)C(=O)C(=C)C |
| InChI | InChI=1S/C9H13NO3/c1-5-10-9(12)13-7(4)8(11)6(2)3/h5,7H,1-2H2,3-4H3,(H,10,12) |
| InChIKey | KHLGXAAJFLQLFR-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|