About 2,4-dimethylpent-1-en-3-one;4-methoxybut-1-ene
2,4-dimethylpent-1-en-3-one;4-methoxybut-1-ene (PubChem CID 157278804) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is 2,4-dimethylpent-1-en-3-one;4-methoxybut-1-ene.
Molecular Properties
| Compound Name | 2,4-dimethylpent-1-en-3-one;4-methoxybut-1-ene |
| PubChem CID | 157278804 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 2,4-dimethylpent-1-en-3-one;4-methoxybut-1-ene |
| SMILES | C=C(C)C(=O)C(C)C.C=CCCOC |
| InChI | InChI=1S/C7H12O.C5H10O/c1-5(2)7(8)6(3)4;1-3-4-5-6-2/h6H,1H2,2-4H3;3H,1,4-5H2,2H3 |
| InChIKey | AZKNBFGWASGQRH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dimethylpent-1-en-3-one;4-methoxybut-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpent-1-en-3-one;4-methoxybut-1-ene?
The IUPAC name of 2,4-dimethylpent-1-en-3-one;4-methoxybut-1-ene (CID 157278804) is 2,4-dimethylpent-1-en-3-one;4-methoxybut-1-ene.
What is the SMILES notation for 2,4-dimethylpent-1-en-3-one;4-methoxybut-1-ene?
The canonical SMILES for 2,4-dimethylpent-1-en-3-one;4-methoxybut-1-ene is C=C(C)C(=O)C(C)C.C=CCCOC.
What is the InChIKey of 2,4-dimethylpent-1-en-3-one;4-methoxybut-1-ene?
The InChIKey is AZKNBFGWASGQRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12O.C5H10O/c1-5(2)7(8)6(3)4;1-3-4-5-6-2/h6H,1H2,2-4H3;3H,1,4-5H2,2H3.
What are the key properties of 2,4-dimethylpent-1-en-3-one;4-methoxybut-1-ene?
2,4-dimethylpent-1-en-3-one;4-methoxybut-1-ene has a molecular weight of 198.31 g/mol, XLogP of 3.00, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpent-1-en-3-one;4-methoxybut-1-ene is sourced from PubChem (CID 157278804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).