C12H22O2 — CID 157278804
2,4-dimethylpent-1-en-3-one;4-methoxybut-1-ene (PubChem CID 157278804) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 2,4-dimethylpent-1-en-3-one;4-methoxybut-1-ene.
| Compound Name | 2,4-dimethylpent-1-en-3-one;4-methoxybut-1-ene |
|---|---|
| PubChem CID | 157278804 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | 2,4-dimethylpent-1-en-3-one;4-methoxybut-1-ene |
| SMILES | C=C(C)C(=O)C(C)C.C=CCCOC |
| InChI | InChI=1S/C7H12O.C5H10O/c1-5(2)7(8)6(3)4;1-3-4-5-6-2/h6H,1H2,2-4H3;3H,1,4-5H2,2H3 |
| InChIKey | AZKNBFGWASGQRH-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|