C8H14O2 — CID 20663748
5-methoxy-2,4-dimethylpent-1-en-3-one (PubChem CID 20663748) has the molecular formula C8H14O2 and a molecular weight of 142.20 g/mol. Its IUPAC name is 5-methoxy-2,4-dimethylpent-1-en-3-one.
| Compound Name | 5-methoxy-2,4-dimethylpent-1-en-3-one |
|---|---|
| PubChem CID | 20663748 |
| Molecular Formula | C8H14O2 |
| Molecular Weight | 142.20 g/mol |
| Exact Mass | 142.10 |
| IUPAC Name | 5-methoxy-2,4-dimethylpent-1-en-3-one |
| SMILES | C=C(C)C(=O)C(C)COC |
| InChI | InChI=1S/C8H14O2/c1-6(2)8(9)7(3)5-10-4/h7H,1,5H2,2-4H3 |
| InChIKey | HSALKNLZCIOCJW-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|