About but-3-en-2-one;N-ethenylacetamide
but-3-en-2-one;N-ethenylacetamide (PubChem CID 139410839) has the molecular formula C8H13NO2
and a molecular weight of 155.20 g/mol. Its IUPAC name is but-3-en-2-one;N-ethenylacetamide.
Molecular Properties
| Compound Name | but-3-en-2-one;N-ethenylacetamide |
| PubChem CID | 139410839 |
| Molecular Formula | C8H13NO2 |
| Molecular Weight | 155.20 g/mol |
| Exact Mass | 155.09 |
| IUPAC Name | but-3-en-2-one;N-ethenylacetamide |
| SMILES | C=CC(C)=O.C=CNC(C)=O |
| InChI | InChI=1S/C4H7NO.C4H6O/c1-3-5-4(2)6;1-3-4(2)5/h3H,1H2,2H3,(H,5,6);3H,1H2,2H3 |
| InChIKey | FQZWKDIVVJOCKF-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.20 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze but-3-en-2-one;N-ethenylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-3-en-2-one;N-ethenylacetamide?
The IUPAC name of but-3-en-2-one;N-ethenylacetamide (CID 139410839) is but-3-en-2-one;N-ethenylacetamide.
What is the SMILES notation for but-3-en-2-one;N-ethenylacetamide?
The canonical SMILES for but-3-en-2-one;N-ethenylacetamide is C=CC(C)=O.C=CNC(C)=O.
What is the InChIKey of but-3-en-2-one;N-ethenylacetamide?
The InChIKey is FQZWKDIVVJOCKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO.C4H6O/c1-3-5-4(2)6;1-3-4(2)5/h3H,1H2,2H3,(H,5,6);3H,1H2,2H3.
What are the key properties of but-3-en-2-one;N-ethenylacetamide?
but-3-en-2-one;N-ethenylacetamide has a molecular weight of 155.20 g/mol, XLogP of 1.03, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for but-3-en-2-one;N-ethenylacetamide is sourced from PubChem (CID 139410839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).