C10H22N2O2S2 — CID 158320858
N-ethenylacetamide;methanethiol;N-(2-methylsulfanylethyl)acetamide (PubChem CID 158320858) has the molecular formula C10H22N2O2S2 and a molecular weight of 266.43 g/mol. Its IUPAC name is N-ethenylacetamide;methanethiol;N-(2-methylsulfanylethyl)acetamide.
| Compound Name | N-ethenylacetamide;methanethiol;N-(2-methylsulfanylethyl)acetamide |
|---|---|
| PubChem CID | 158320858 |
| Molecular Formula | C10H22N2O2S2 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | N-ethenylacetamide;methanethiol;N-(2-methylsulfanylethyl)acetamide |
| SMILES | C=CNC(C)=O.CS.CSCCNC(C)=O |
| InChI | InChI=1S/C5H11NOS.C4H7NO.CH4S/c1-5(7)6-3-4-8-2;1-3-5-4(2)6;1-2/h3-4H2,1-2H3,(H,6,7);3H,1H2,2H3,(H,5,6);2H,1H3 |
| InChIKey | GOVGILAZDYQZEP-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|