C6H10NNaO4S — CID 23715190
sodium;ethenesulfonate;N-ethenylacetamide (PubChem CID 23715190) has the molecular formula C6H10NNaO4S and a molecular weight of 215.21 g/mol. Its IUPAC name is sodium;ethenesulfonate;N-ethenylacetamide.
| Compound Name | sodium;ethenesulfonate;N-ethenylacetamide |
|---|---|
| PubChem CID | 23715190 |
| Molecular Formula | C6H10NNaO4S |
| Molecular Weight | 215.21 g/mol |
| Exact Mass | 215.02 |
| IUPAC Name | sodium;ethenesulfonate;N-ethenylacetamide |
| SMILES | C=CNC(C)=O.C=CS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C4H7NO.C2H4O3S.Na/c1-3-5-4(2)6;1-2-6(3,4)5;/h3H,1H2,2H3,(H,5,6);2H,1H2,(H,3,4,5);/q;;+1/p-1 |
| InChIKey | ZQDSKSBJTBXLHU-UHFFFAOYSA-M |
| XLogP | -3.05 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.21 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|