C6H10NO4S- — CID 86736729
but-3-enamide;ethenesulfonate (PubChem CID 86736729) has the molecular formula C6H10NO4S- and a molecular weight of 192.22 g/mol. Its IUPAC name is but-3-enamide;ethenesulfonate.
| Compound Name | but-3-enamide;ethenesulfonate |
|---|---|
| PubChem CID | 86736729 |
| Molecular Formula | C6H10NO4S- |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.03 |
| IUPAC Name | but-3-enamide;ethenesulfonate |
| SMILES | C=CCC(N)=O.C=CS(=O)(=O)[O-] |
| InChI | InChI=1S/C4H7NO.C2H4O3S/c1-2-3-4(5)6;1-2-6(3,4)5/h2H,1,3H2,(H2,5,6);2H,1H2,(H,3,4,5)/p-1 |
| InChIKey | ORJJHGUOCLFJSR-UHFFFAOYSA-M |
| XLogP | -0.28 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|