About sodium;but-3-enamide;hydride
sodium;but-3-enamide;hydride (PubChem CID 175440454) has the molecular formula C4H8NNaO
and a molecular weight of 109.10 g/mol. Its IUPAC name is sodium;but-3-enamide;hydride.
Molecular Properties
| Compound Name | sodium;but-3-enamide;hydride |
| PubChem CID | 175440454 |
| Molecular Formula | C4H8NNaO |
| Molecular Weight | 109.10 g/mol |
| Exact Mass | 109.05 |
| IUPAC Name | sodium;but-3-enamide;hydride |
| SMILES | C=CCC(N)=O.[H-].[Na+] |
| InChI | InChI=1S/C4H7NO.Na.H/c1-2-3-4(5)6;;/h2H,1,3H2,(H2,5,6);;/q;+1;-1 |
| InChIKey | JKMPLAOLWKWVIG-UHFFFAOYSA-N |
| XLogP | -2.84 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.10 |
| LogP ≤ 5 | -2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze sodium;but-3-enamide;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;but-3-enamide;hydride?
The IUPAC name of sodium;but-3-enamide;hydride (CID 175440454) is sodium;but-3-enamide;hydride.
What is the SMILES notation for sodium;but-3-enamide;hydride?
The canonical SMILES for sodium;but-3-enamide;hydride is C=CCC(N)=O.[H-].[Na+].
What is the InChIKey of sodium;but-3-enamide;hydride?
The InChIKey is JKMPLAOLWKWVIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H7NO.Na.H/c1-2-3-4(5)6;;/h2H,1,3H2,(H2,5,6);;/q;+1;-1.
What are the key properties of sodium;but-3-enamide;hydride?
sodium;but-3-enamide;hydride has a molecular weight of 109.10 g/mol, XLogP of -2.84, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;but-3-enamide;hydride is sourced from PubChem (CID 175440454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).