About (213C)pent-4-en-2-one
(213C)pent-4-en-2-one (PubChem CID 173180315) has the molecular formula C5H8O
and a molecular weight of 85.11 g/mol. Its IUPAC name is (213C)pent-4-en-2-one.
Molecular Properties
| Compound Name | (213C)pent-4-en-2-one |
| PubChem CID | 173180315 |
| Molecular Formula | C5H8O |
| Molecular Weight | 85.11 g/mol |
| Exact Mass | 85.06 |
| IUPAC Name | (213C)pent-4-en-2-one |
| SMILES | C=CC[13C](C)=O |
| InChI | InChI=1S/C5H8O/c1-3-4-5(2)6/h3H,1,4H2,2H3/i5+1 |
| InChIKey | PNJWIWWMYCMZRO-HOSYLAQJSA-N |
| XLogP | 1.15 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 85.11 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (213C)pent-4-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (213C)pent-4-en-2-one?
The IUPAC name of (213C)pent-4-en-2-one (CID 173180315) is (213C)pent-4-en-2-one.
What is the SMILES notation for (213C)pent-4-en-2-one?
The canonical SMILES for (213C)pent-4-en-2-one is C=CC[13C](C)=O.
What is the InChIKey of (213C)pent-4-en-2-one?
The InChIKey is PNJWIWWMYCMZRO-HOSYLAQJSA-N. The full InChI is InChI=1S/C5H8O/c1-3-4-5(2)6/h3H,1,4H2,2H3/i5+1.
What are the key properties of (213C)pent-4-en-2-one?
(213C)pent-4-en-2-one has a molecular weight of 85.11 g/mol, XLogP of 1.15, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (213C)pent-4-en-2-one is sourced from PubChem (CID 173180315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).