About N-methylbut-3-enamide
N-methylbut-3-enamide (PubChem CID 13113546) has the molecular formula C5H9NO
and a molecular weight of 99.13 g/mol. Its IUPAC name is N-methylbut-3-enamide.
Molecular Properties
| Compound Name | N-methylbut-3-enamide |
| PubChem CID | 13113546 |
| Molecular Formula | C5H9NO |
| Molecular Weight | 99.13 g/mol |
| Exact Mass | 99.07 |
| IUPAC Name | N-methylbut-3-enamide |
| SMILES | C=CCC(=O)NC |
| InChI | InChI=1S/C5H9NO/c1-3-4-5(7)6-2/h3H,1,4H2,2H3,(H,6,7) |
| InChIKey | LRSCEVQEEBMAHN-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 99.13 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-methylbut-3-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylbut-3-enamide?
The IUPAC name of N-methylbut-3-enamide (CID 13113546) is N-methylbut-3-enamide.
What is the SMILES notation for N-methylbut-3-enamide?
The canonical SMILES for N-methylbut-3-enamide is C=CCC(=O)NC.
What is the InChIKey of N-methylbut-3-enamide?
The InChIKey is LRSCEVQEEBMAHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9NO/c1-3-4-5(7)6-2/h3H,1,4H2,2H3,(H,6,7).
What are the key properties of N-methylbut-3-enamide?
N-methylbut-3-enamide has a molecular weight of 99.13 g/mol, XLogP of 0.31, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylbut-3-enamide is sourced from PubChem (CID 13113546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).