C6H11N — CID 144973038
N-methylpenta-1,4-dien-2-amine (PubChem CID 144973038) has the molecular formula C6H11N and a molecular weight of 97.16 g/mol. Its IUPAC name is N-methylpenta-1,4-dien-2-amine.
| Compound Name | N-methylpenta-1,4-dien-2-amine |
|---|---|
| PubChem CID | 144973038 |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | N-methylpenta-1,4-dien-2-amine |
| SMILES | C=CCC(=C)NC |
| InChI | InChI=1S/C6H11N/c1-4-5-6(2)7-3/h4,7H,1-2,5H2,3H3 |
| InChIKey | USGMMLSLDQDDLG-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|