C8H15NO — CID 88966208
4-methoxy-N-methylhexa-1,5-dien-2-amine (PubChem CID 88966208) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is 4-methoxy-N-methylhexa-1,5-dien-2-amine.
| Compound Name | 4-methoxy-N-methylhexa-1,5-dien-2-amine |
|---|---|
| PubChem CID | 88966208 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 4-methoxy-N-methylhexa-1,5-dien-2-amine |
| SMILES | C=CC(CC(=C)NC)OC |
| InChI | InChI=1S/C8H15NO/c1-5-8(10-4)6-7(2)9-3/h5,8-9H,1-2,6H2,3-4H3 |
| InChIKey | FVGVWWPVILQFHO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|