C10H19NO — CID 144515472
(2Z)-6-methoxy-2-methylocta-2,7-dien-1-amine (PubChem CID 144515472) has the molecular formula C10H19NO and a molecular weight of 169.27 g/mol. Its IUPAC name is (2Z)-6-methoxy-2-methylocta-2,7-dien-1-amine.
| Compound Name | (2Z)-6-methoxy-2-methylocta-2,7-dien-1-amine |
|---|---|
| PubChem CID | 144515472 |
| Molecular Formula | C10H19NO |
| Molecular Weight | 169.27 g/mol |
| Exact Mass | 169.15 |
| IUPAC Name | (2Z)-6-methoxy-2-methylocta-2,7-dien-1-amine |
| SMILES | C=CC(CC/C=C(/C)CN)OC |
| InChI | InChI=1S/C10H19NO/c1-4-10(12-3)7-5-6-9(2)8-11/h4,6,10H,1,5,7-8,11H2,2-3H3/b9-6- |
| InChIKey | ADTNIDUCLXXYRV-TWGQIWQCSA-N |
| XLogP | 1.87 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|