C16H32O3 — CID 156747026
12,12-dimethoxy-5,9-dimethyldodec-8-en-2-ol (PubChem CID 156747026) has the molecular formula C16H32O3 and a molecular weight of 272.43 g/mol. Its IUPAC name is 12,12-dimethoxy-5,9-dimethyldodec-8-en-2-ol.
| Compound Name | 12,12-dimethoxy-5,9-dimethyldodec-8-en-2-ol |
|---|---|
| PubChem CID | 156747026 |
| Molecular Formula | C16H32O3 |
| Molecular Weight | 272.43 g/mol |
| Exact Mass | 272.24 |
| IUPAC Name | 12,12-dimethoxy-5,9-dimethyldodec-8-en-2-ol |
| SMILES | COC(CCC(C)=CCCC(C)CCC(C)O)OC |
| InChI | InChI=1S/C16H32O3/c1-13(9-11-15(3)17)7-6-8-14(2)10-12-16(18-4)19-5/h8,13,15-17H,6-7,9-12H2,1-5H3 |
| InChIKey | VNMAVIHZEOWPQC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.43 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|