C16H29ClO — CID 88656729
(2Z,6Z)-1-chloro-12-methoxy-2,6,10-trimethyldodeca-2,6-diene (PubChem CID 88656729) has the molecular formula C16H29ClO and a molecular weight of 272.86 g/mol. Its IUPAC name is (2Z,6Z)-1-chloro-12-methoxy-2,6,10-trimethyldodeca-2,6-diene.
| Compound Name | (2Z,6Z)-1-chloro-12-methoxy-2,6,10-trimethyldodeca-2,6-diene |
|---|---|
| PubChem CID | 88656729 |
| Molecular Formula | C16H29ClO |
| Molecular Weight | 272.86 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (2Z,6Z)-1-chloro-12-methoxy-2,6,10-trimethyldodeca-2,6-diene |
| SMILES | COCCC(C)CC/C=C(/C)CC/C=C(/C)CCl |
| InChI | InChI=1S/C16H29ClO/c1-14(8-6-10-16(3)13-17)7-5-9-15(2)11-12-18-4/h7,10,15H,5-6,8-9,11-13H2,1-4H3/b14-7-,16-10- |
| InChIKey | DZXSELRDFUHAJG-SVQFLZJQSA-N |
| XLogP | 5.35 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.86 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|