C30H54O2 — CID 87864001
(2Z)-1,1-bis[(3S)-3,7-dimethyloct-6-enoxy]-3,7-dimethylocta-2,6-diene (PubChem CID 87864001) has the molecular formula C30H54O2 and a molecular weight of 446.76 g/mol. Its IUPAC name is (2Z)-1,1-bis[(3S)-3,7-dimethyloct-6-enoxy]-3,7-dimethylocta-2,6-diene.
| Compound Name | (2Z)-1,1-bis[(3S)-3,7-dimethyloct-6-enoxy]-3,7-dimethylocta-2,6-diene |
|---|---|
| PubChem CID | 87864001 |
| Molecular Formula | C30H54O2 |
| Molecular Weight | 446.76 g/mol |
| Exact Mass | 446.41 |
| IUPAC Name | (2Z)-1,1-bis[(3S)-3,7-dimethyloct-6-enoxy]-3,7-dimethylocta-2,6-diene |
| SMILES | CC(C)=CCC/C(C)=C\C(OCC[C@@H](C)CCC=C(C)C)OCC[C@@H](C)CCC=C(C)C |
| InChI | InChI=1S/C30H54O2/c1-24(2)13-10-16-27(7)19-21-31-30(23-29(9)18-12-15-26(5)6)32-22-20-28(8)17-11-14-25(3)4/h13-15,23,27-28,30H,10-12,16-22H2,1-9H3/b29-23-/t27-,28-/m0/s1 |
| InChIKey | NRVCIUYZBWBRCJ-DYHKCACQSA-N |
| XLogP | 9.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.76 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|