C30H50O2 — CID 140578450
1,1-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-3,7-dimethylocta-2,6-diene (PubChem CID 140578450) has the molecular formula C30H50O2 and a molecular weight of 442.73 g/mol. Its IUPAC name is 1,1-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-3,7-dimethylocta-2,6-diene.
| Compound Name | 1,1-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-3,7-dimethylocta-2,6-diene |
|---|---|
| PubChem CID | 140578450 |
| Molecular Formula | C30H50O2 |
| Molecular Weight | 442.73 g/mol |
| Exact Mass | 442.38 |
| IUPAC Name | 1,1-bis[(2E)-3,7-dimethylocta-2,6-dienoxy]-3,7-dimethylocta-2,6-diene |
| SMILES | CC(C)=CCCC(C)=CC(OC/C=C(\C)CCC=C(C)C)OC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C30H50O2/c1-24(2)13-10-16-27(7)19-21-31-30(23-29(9)18-12-15-26(5)6)32-22-20-28(8)17-11-14-25(3)4/h13-15,19-20,23,30H,10-12,16-18,21-22H2,1-9H3/b27-19+,28-20+,29-23? |
| InChIKey | ZYJYHCZZHUCTGC-BXRRKJERSA-N |
| XLogP | 9.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.73 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|