C14H20F6O2 — CID 90239872
(2Z)-3,7-dimethyl-1,1-bis(2,2,2-trifluoroethoxy)octa-2,6-diene (PubChem CID 90239872) has the molecular formula C14H20F6O2 and a molecular weight of 334.30 g/mol. Its IUPAC name is (2Z)-3,7-dimethyl-1,1-bis(2,2,2-trifluoroethoxy)octa-2,6-diene.
| Compound Name | (2Z)-3,7-dimethyl-1,1-bis(2,2,2-trifluoroethoxy)octa-2,6-diene |
|---|---|
| PubChem CID | 90239872 |
| Molecular Formula | C14H20F6O2 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | (2Z)-3,7-dimethyl-1,1-bis(2,2,2-trifluoroethoxy)octa-2,6-diene |
| SMILES | CC(C)=CCC/C(C)=C\C(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C14H20F6O2/c1-10(2)5-4-6-11(3)7-12(21-8-13(15,16)17)22-9-14(18,19)20/h5,7,12H,4,6,8-9H2,1-3H3/b11-7- |
| InChIKey | YKUDOSKVHVSJHC-XFFZJAGNSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|