C14H22F6O2 — CID 90238868
(6R)-2,6-dimethyl-8,8-bis(2,2,2-trifluoroethoxy)oct-2-ene (PubChem CID 90238868) has the molecular formula C14H22F6O2 and a molecular weight of 336.32 g/mol. Its IUPAC name is (6R)-2,6-dimethyl-8,8-bis(2,2,2-trifluoroethoxy)oct-2-ene.
| Compound Name | (6R)-2,6-dimethyl-8,8-bis(2,2,2-trifluoroethoxy)oct-2-ene |
|---|---|
| PubChem CID | 90238868 |
| Molecular Formula | C14H22F6O2 |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | (6R)-2,6-dimethyl-8,8-bis(2,2,2-trifluoroethoxy)oct-2-ene |
| SMILES | CC(C)=CCC[C@@H](C)CC(OCC(F)(F)F)OCC(F)(F)F |
| InChI | InChI=1S/C14H22F6O2/c1-10(2)5-4-6-11(3)7-12(21-8-13(15,16)17)22-9-14(18,19)20/h5,11-12H,4,6-9H2,1-3H3/t11-/m1/s1 |
| InChIKey | MQPUIRNCPRTAGG-LLVKDONJSA-N |
| XLogP | 5.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|