C9H19N — CID 163211564
(2R)-2,6-dimethylhept-5-en-1-amine (PubChem CID 163211564) has the molecular formula C9H19N and a molecular weight of 141.26 g/mol. Its IUPAC name is (2R)-2,6-dimethylhept-5-en-1-amine.
| Compound Name | (2R)-2,6-dimethylhept-5-en-1-amine |
|---|---|
| PubChem CID | 163211564 |
| Molecular Formula | C9H19N |
| Molecular Weight | 141.26 g/mol |
| Exact Mass | 141.15 |
| IUPAC Name | (2R)-2,6-dimethylhept-5-en-1-amine |
| SMILES | CC(C)=CCC[C@@H](C)CN |
| InChI | InChI=1S/C9H19N/c1-8(2)5-4-6-9(3)7-10/h5,9H,4,6-7,10H2,1-3H3/t9-/m1/s1 |
| InChIKey | AELVYGTZFLSGRA-SECBINFHSA-N |
| XLogP | 2.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.26 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|