C12H21FO — CID 138375732
(2Z)-3-fluoro-5,9-dimethyldeca-2,8-dien-1-ol (PubChem CID 138375732) has the molecular formula C12H21FO and a molecular weight of 200.30 g/mol. Its IUPAC name is (2Z)-3-fluoro-5,9-dimethyldeca-2,8-dien-1-ol.
| Compound Name | (2Z)-3-fluoro-5,9-dimethyldeca-2,8-dien-1-ol |
|---|---|
| PubChem CID | 138375732 |
| Molecular Formula | C12H21FO |
| Molecular Weight | 200.30 g/mol |
| Exact Mass | 200.16 |
| IUPAC Name | (2Z)-3-fluoro-5,9-dimethyldeca-2,8-dien-1-ol |
| SMILES | CC(C)=CCCC(C)C/C(F)=C/CO |
| InChI | InChI=1S/C12H21FO/c1-10(2)5-4-6-11(3)9-12(13)7-8-14/h5,7,11,14H,4,6,8-9H2,1-3H3/b12-7- |
| InChIKey | RUBQLBWHUMIGED-GHXNOFRVSA-N |
| XLogP | 3.60 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|