C10H19ClMg — CID 164665719
magnesium;(6S)-2,6-dimethyloct-2-ene;chloride (PubChem CID 164665719) has the molecular formula C10H19ClMg and a molecular weight of 199.02 g/mol. Its IUPAC name is magnesium;(6S)-2,6-dimethyloct-2-ene;chloride.
| Compound Name | magnesium;(6S)-2,6-dimethyloct-2-ene;chloride |
|---|---|
| PubChem CID | 164665719 |
| Molecular Formula | C10H19ClMg |
| Molecular Weight | 199.02 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | magnesium;(6S)-2,6-dimethyloct-2-ene;chloride |
| SMILES | [CH2-]C[C@H](C)CCC=C(C)C.[Cl-].[Mg+2] |
| InChI | InChI=1S/C10H19.ClH.Mg/c1-5-10(4)8-6-7-9(2)3;;/h7,10H,1,5-6,8H2,2-4H3;1H;/q-1;;+2/p-1/t10-;;/m0../s1 |
| InChIKey | WFQCPWDMGPIBSA-XRIOVQLTSA-M |
| XLogP | 0.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.02 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|