About magnesium;(6S)-2,6-dimethyloct-2-ene;chloride
magnesium;(6S)-2,6-dimethyloct-2-ene;chloride (PubChem CID 164665719) has the molecular formula C10H19ClMg
and a molecular weight of 199.02 g/mol. Its IUPAC name is magnesium;(6S)-2,6-dimethyloct-2-ene;chloride.
Molecular Properties
| Compound Name | magnesium;(6S)-2,6-dimethyloct-2-ene;chloride |
| PubChem CID | 164665719 |
| Molecular Formula | C10H19ClMg |
| Molecular Weight | 199.02 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | magnesium;(6S)-2,6-dimethyloct-2-ene;chloride |
| SMILES | [CH2-]C[C@H](C)CCC=C(C)C.[Cl-].[Mg+2] |
| InChI | InChI=1S/C10H19.ClH.Mg/c1-5-10(4)8-6-7-9(2)3;;/h7,10H,1,5-6,8H2,2-4H3;1H;/q-1;;+2/p-1/t10-;;/m0../s1 |
| InChIKey | WFQCPWDMGPIBSA-XRIOVQLTSA-M |
| XLogP | 0.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.02 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze magnesium;(6S)-2,6-dimethyloct-2-ene;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;(6S)-2,6-dimethyloct-2-ene;chloride?
The IUPAC name of magnesium;(6S)-2,6-dimethyloct-2-ene;chloride (CID 164665719) is magnesium;(6S)-2,6-dimethyloct-2-ene;chloride.
What is the SMILES notation for magnesium;(6S)-2,6-dimethyloct-2-ene;chloride?
The canonical SMILES for magnesium;(6S)-2,6-dimethyloct-2-ene;chloride is [CH2-]C[C@H](C)CCC=C(C)C.[Cl-].[Mg+2].
What is the InChIKey of magnesium;(6S)-2,6-dimethyloct-2-ene;chloride?
The InChIKey is WFQCPWDMGPIBSA-XRIOVQLTSA-M. The full InChI is InChI=1S/C10H19.ClH.Mg/c1-5-10(4)8-6-7-9(2)3;;/h7,10H,1,5-6,8H2,2-4H3;1H;/q-1;;+2/p-1/t10-;;/m0../s1.
What are the key properties of magnesium;(6S)-2,6-dimethyloct-2-ene;chloride?
magnesium;(6S)-2,6-dimethyloct-2-ene;chloride has a molecular weight of 199.02 g/mol, XLogP of 0.22, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;(6S)-2,6-dimethyloct-2-ene;chloride is sourced from PubChem (CID 164665719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).