C13H24S2 — CID 11299561
(4R)-4,8-dimethyl-1,1-bis(methylsulfanyl)nona-1,7-diene (PubChem CID 11299561) has the molecular formula C13H24S2 and a molecular weight of 244.47 g/mol. Its IUPAC name is (4R)-4,8-dimethyl-1,1-bis(methylsulfanyl)nona-1,7-diene.
| Compound Name | (4R)-4,8-dimethyl-1,1-bis(methylsulfanyl)nona-1,7-diene |
|---|---|
| PubChem CID | 11299561 |
| Molecular Formula | C13H24S2 |
| Molecular Weight | 244.47 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | (4R)-4,8-dimethyl-1,1-bis(methylsulfanyl)nona-1,7-diene |
| SMILES | CSC(=CC[C@H](C)CCC=C(C)C)SC |
| InChI | InChI=1S/C13H24S2/c1-11(2)7-6-8-12(3)9-10-13(14-4)15-5/h7,10,12H,6,8-9H2,1-5H3/t12-/m1/s1 |
| InChIKey | MBMNVGMDDXXCCB-GFCCVEGCSA-N |
| XLogP | 5.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|