C11H19Cl — CID 138971565
(1E)-1-chloro-4,8-dimethylnona-1,7-diene (PubChem CID 138971565) has the molecular formula C11H19Cl and a molecular weight of 186.73 g/mol. Its IUPAC name is (1E)-1-chloro-4,8-dimethylnona-1,7-diene.
| Compound Name | (1E)-1-chloro-4,8-dimethylnona-1,7-diene |
|---|---|
| PubChem CID | 138971565 |
| Molecular Formula | C11H19Cl |
| Molecular Weight | 186.73 g/mol |
| Exact Mass | 186.12 |
| IUPAC Name | (1E)-1-chloro-4,8-dimethylnona-1,7-diene |
| SMILES | CC(C)=CCCC(C)C/C=C/Cl |
| InChI | InChI=1S/C11H19Cl/c1-10(2)6-4-7-11(3)8-5-9-12/h5-6,9,11H,4,7-8H2,1-3H3/b9-5+ |
| InChIKey | DZQWBSLIRVWAME-WEVVVXLNSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.73 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|